C19H17N3O7 — CID 27173719
N-[2-(4-methoxyphenoxy)ethyl]-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide (PubChem CID 27173719) has the molecular formula C19H17N3O7 and a molecular weight of 399.36 g/mol. Its IUPAC name is N-[2-(4-methoxyphenoxy)ethyl]-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide.
| Compound Name | N-[2-(4-methoxyphenoxy)ethyl]-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 27173719 |
| Molecular Formula | C19H17N3O7 |
| Molecular Weight | 399.36 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | N-[2-(4-methoxyphenoxy)ethyl]-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide |
| SMILES | COc1ccc(OCCNC(=O)CN2C(=O)c3cccc([N+](=O)[O-])c3C2=O)cc1 |
| InChI | InChI=1S/C19H17N3O7/c1-28-12-5-7-13(8-6-12)29-10-9-20-16(23)11-21-18(24)14-3-2-4-15(22(26)27)17(14)19(21)25/h2-8H,9-11H2,1H3,(H,20,23) |
| InChIKey | HGMYSCHLVSINRE-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.36 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|