C16H9Cl2FN2O3 — CID 113201778
N-(2,5-dichlorophenyl)-2-(4-fluoro-1,3-dioxoisoindol-2-yl)acetamide (PubChem CID 113201778) has the molecular formula C16H9Cl2FN2O3 and a molecular weight of 367.16 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-2-(4-fluoro-1,3-dioxoisoindol-2-yl)acetamide.
| Compound Name | N-(2,5-dichlorophenyl)-2-(4-fluoro-1,3-dioxoisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 113201778 |
| Molecular Formula | C16H9Cl2FN2O3 |
| Molecular Weight | 367.16 g/mol |
| Exact Mass | 366.00 |
| IUPAC Name | N-(2,5-dichlorophenyl)-2-(4-fluoro-1,3-dioxoisoindol-2-yl)acetamide |
| SMILES | O=C(CN1C(=O)c2cccc(F)c2C1=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C16H9Cl2FN2O3/c17-8-4-5-10(18)12(6-8)20-13(22)7-21-15(23)9-2-1-3-11(19)14(9)16(21)24/h1-6H,7H2,(H,20,22) |
| InChIKey | VNNURERYUMIBOH-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.16 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|