C10H6FNO4 — CID 130161137
2-(4-fluoro-1,3-dioxoisoindol-2-yl)acetic acid (PubChem CID 130161137) has the molecular formula C10H6FNO4 and a molecular weight of 223.16 g/mol. Its IUPAC name is 2-(4-fluoro-1,3-dioxoisoindol-2-yl)acetic acid.
| Compound Name | 2-(4-fluoro-1,3-dioxoisoindol-2-yl)acetic acid |
|---|---|
| PubChem CID | 130161137 |
| Molecular Formula | C10H6FNO4 |
| Molecular Weight | 223.16 g/mol |
| Exact Mass | 223.03 |
| IUPAC Name | 2-(4-fluoro-1,3-dioxoisoindol-2-yl)acetic acid |
| SMILES | O=C(O)CN1C(=O)c2cccc(F)c2C1=O |
| InChI | InChI=1S/C10H6FNO4/c11-6-3-1-2-5-8(6)10(16)12(9(5)15)4-7(13)14/h1-3H,4H2,(H,13,14) |
| InChIKey | SLCVGIYERKJJHE-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.16 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|