C16H10ClNO5 — CID 752168
2-[4-(4-chlorophenoxy)-1,3-dioxoisoindol-2-yl]acetic acid (PubChem CID 752168) has the molecular formula C16H10ClNO5 and a molecular weight of 331.71 g/mol. Its IUPAC name is 2-[4-(4-chlorophenoxy)-1,3-dioxoisoindol-2-yl]acetic acid.
| Compound Name | 2-[4-(4-chlorophenoxy)-1,3-dioxoisoindol-2-yl]acetic acid |
|---|---|
| PubChem CID | 752168 |
| Molecular Formula | C16H10ClNO5 |
| Molecular Weight | 331.71 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | 2-[4-(4-chlorophenoxy)-1,3-dioxoisoindol-2-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)c2cccc(Oc3ccc(Cl)cc3)c2C1=O |
| InChI | InChI=1S/C16H10ClNO5/c17-9-4-6-10(7-5-9)23-12-3-1-2-11-14(12)16(22)18(15(11)21)8-13(19)20/h1-7H,8H2,(H,19,20) |
| InChIKey | PAUPVMNMNADDGB-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.71 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|