C16H11NO5 — CID 66713203
2-(1,3-dioxo-5-phenoxyisoindol-2-yl)acetic acid (PubChem CID 66713203) has the molecular formula C16H11NO5 and a molecular weight of 297.27 g/mol. Its IUPAC name is 2-(1,3-dioxo-5-phenoxyisoindol-2-yl)acetic acid.
| Compound Name | 2-(1,3-dioxo-5-phenoxyisoindol-2-yl)acetic acid |
|---|---|
| PubChem CID | 66713203 |
| Molecular Formula | C16H11NO5 |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 2-(1,3-dioxo-5-phenoxyisoindol-2-yl)acetic acid |
| SMILES | O=C(O)CN1C(=O)c2ccc(Oc3ccccc3)cc2C1=O |
| InChI | InChI=1S/C16H11NO5/c18-14(19)9-17-15(20)12-7-6-11(8-13(12)16(17)21)22-10-4-2-1-3-5-10/h1-8H,9H2,(H,18,19) |
| InChIKey | FFYAWJNRPVNAHT-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|