C21H13NO5 — CID 1360682
2-(1,3-dioxo-5-phenoxyisoindol-2-yl)benzoic acid (PubChem CID 1360682) has the molecular formula C21H13NO5 and a molecular weight of 359.34 g/mol. Its IUPAC name is 2-(1,3-dioxo-5-phenoxyisoindol-2-yl)benzoic acid.
| Compound Name | 2-(1,3-dioxo-5-phenoxyisoindol-2-yl)benzoic acid |
|---|---|
| PubChem CID | 1360682 |
| Molecular Formula | C21H13NO5 |
| Molecular Weight | 359.34 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | 2-(1,3-dioxo-5-phenoxyisoindol-2-yl)benzoic acid |
| SMILES | O=C(O)c1ccccc1N1C(=O)c2ccc(Oc3ccccc3)cc2C1=O |
| InChI | InChI=1S/C21H13NO5/c23-19-15-11-10-14(27-13-6-2-1-3-7-13)12-17(15)20(24)22(19)18-9-5-4-8-16(18)21(25)26/h1-12H,(H,25,26) |
| InChIKey | QSHZJFOQEYUGGQ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.34 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|