C44H32N2O6 — CID 3108252
2-(2,3-dimethylphenyl)-5-[4-[4-[2-(2,3-dimethylphenyl)-1,3-dioxoisoindol-5-yl]oxyphenyl]phenoxy]isoindole-1,3-dione (PubChem CID 3108252) has the molecular formula C44H32N2O6 and a molecular weight of 684.75 g/mol. Its IUPAC name is 2-(2,3-dimethylphenyl)-5-[4-[4-[2-(2,3-dimethylphenyl)-1,3-dioxoisoindol-5-yl]oxyphenyl]phenoxy]isoindole-1,3-dione.
| Compound Name | 2-(2,3-dimethylphenyl)-5-[4-[4-[2-(2,3-dimethylphenyl)-1,3-dioxoisoindol-5-yl]oxyphenyl]phenoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 3108252 |
| Molecular Formula | C44H32N2O6 |
| Molecular Weight | 684.75 g/mol |
| Exact Mass | 684.23 |
| IUPAC Name | 2-(2,3-dimethylphenyl)-5-[4-[4-[2-(2,3-dimethylphenyl)-1,3-dioxoisoindol-5-yl]oxyphenyl]phenoxy]isoindole-1,3-dione |
| SMILES | Cc1cccc(N2C(=O)c3ccc(Oc4ccc(-c5ccc(Oc6ccc7c(c6)C(=O)N(c6cccc(C)c6C)C7=O)cc5)cc4)cc3C2=O)c1C |
| InChI | InChI=1S/C44H32N2O6/c1-25-7-5-9-39(27(25)3)45-41(47)35-21-19-33(23-37(35)43(45)49)51-31-15-11-29(12-16-31)30-13-17-32(18-14-30)52-34-20-22-36-38(24-34)44(50)46(42(36)48)40-10-6-8-26(2)28(40)4/h5-24H,1-4H3 |
| InChIKey | BUIMSWVCULYGMM-UHFFFAOYSA-N |
| XLogP | 9.77 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.75 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|