C22H13ClNO5- — CID 5060209
3-[5-(4-chlorophenoxy)-1,3-dioxoisoindol-2-yl]-4-methylbenzoate (PubChem CID 5060209) has the molecular formula C22H13ClNO5- and a molecular weight of 406.80 g/mol. Its IUPAC name is 3-[5-(4-chlorophenoxy)-1,3-dioxoisoindol-2-yl]-4-methylbenzoate.
| Compound Name | 3-[5-(4-chlorophenoxy)-1,3-dioxoisoindol-2-yl]-4-methylbenzoate |
|---|---|
| PubChem CID | 5060209 |
| Molecular Formula | C22H13ClNO5- |
| Molecular Weight | 406.80 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | 3-[5-(4-chlorophenoxy)-1,3-dioxoisoindol-2-yl]-4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)[O-])cc1N1C(=O)c2ccc(Oc3ccc(Cl)cc3)cc2C1=O |
| InChI | InChI=1S/C22H14ClNO5/c1-12-2-3-13(22(27)28)10-19(12)24-20(25)17-9-8-16(11-18(17)21(24)26)29-15-6-4-14(23)5-7-15/h2-11H,1H3,(H,27,28)/p-1 |
| InChIKey | DELSXABXULGRME-UHFFFAOYSA-M |
| XLogP | 3.60 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.80 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|