C16H9N2O7- — CID 7070856
2-(4-methoxy-2-nitrophenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 7070856) has the molecular formula C16H9N2O7- and a molecular weight of 341.26 g/mol. Its IUPAC name is 2-(4-methoxy-2-nitrophenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | 2-(4-methoxy-2-nitrophenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 7070856 |
| Molecular Formula | C16H9N2O7- |
| Molecular Weight | 341.26 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | 2-(4-methoxy-2-nitrophenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | COc1ccc(N2C(=O)c3ccc(C(=O)[O-])cc3C2=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H10N2O7/c1-25-9-3-5-12(13(7-9)18(23)24)17-14(19)10-4-2-8(16(21)22)6-11(10)15(17)20/h2-7H,1H3,(H,21,22)/p-1 |
| InChIKey | OWDSCKCOQPCTGM-UHFFFAOYSA-M |
| XLogP | 0.77 |
| TPSA | 129.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.26 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|