C15H6FN2O6- — CID 5124133
2-(2-fluoro-5-nitrophenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 5124133) has the molecular formula C15H6FN2O6- and a molecular weight of 329.22 g/mol. Its IUPAC name is 2-(2-fluoro-5-nitrophenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | 2-(2-fluoro-5-nitrophenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 5124133 |
| Molecular Formula | C15H6FN2O6- |
| Molecular Weight | 329.22 g/mol |
| Exact Mass | 329.02 |
| IUPAC Name | 2-(2-fluoro-5-nitrophenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | O=C([O-])c1ccc2c(c1)C(=O)N(c1cc([N+](=O)[O-])ccc1F)C2=O |
| InChI | InChI=1S/C15H7FN2O6/c16-11-4-2-8(18(23)24)6-12(11)17-13(19)9-3-1-7(15(21)22)5-10(9)14(17)20/h1-6H,(H,21,22)/p-1 |
| InChIKey | IPIZNNIZVIDFOO-UHFFFAOYSA-M |
| XLogP | 0.90 |
| TPSA | 120.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.22 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|