C22H10N4O8 — CID 19370940
5-nitro-2-[2-(5-nitro-1,3-dioxoisoindol-2-yl)phenyl]isoindole-1,3-dione (PubChem CID 19370940) has the molecular formula C22H10N4O8 and a molecular weight of 458.34 g/mol. Its IUPAC name is 5-nitro-2-[2-(5-nitro-1,3-dioxoisoindol-2-yl)phenyl]isoindole-1,3-dione.
| Compound Name | 5-nitro-2-[2-(5-nitro-1,3-dioxoisoindol-2-yl)phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 19370940 |
| Molecular Formula | C22H10N4O8 |
| Molecular Weight | 458.34 g/mol |
| Exact Mass | 458.05 |
| IUPAC Name | 5-nitro-2-[2-(5-nitro-1,3-dioxoisoindol-2-yl)phenyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccc([N+](=O)[O-])cc2C(=O)N1c1ccccc1N1C(=O)c2ccc([N+](=O)[O-])cc2C1=O |
| InChI | InChI=1S/C22H10N4O8/c27-19-13-7-5-11(25(31)32)9-15(13)21(29)23(19)17-3-1-2-4-18(17)24-20(28)14-8-6-12(26(33)34)10-16(14)22(24)30/h1-10H |
| InChIKey | GVKNCVVIYMJSOD-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 161.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.34 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|