C23H15N3O8 — CID 126185388
(3-nitrophenyl)methyl 2-(4-methyl-2-nitrophenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 126185388) has the molecular formula C23H15N3O8 and a molecular weight of 461.39 g/mol. Its IUPAC name is (3-nitrophenyl)methyl 2-(4-methyl-2-nitrophenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | (3-nitrophenyl)methyl 2-(4-methyl-2-nitrophenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 126185388 |
| Molecular Formula | C23H15N3O8 |
| Molecular Weight | 461.39 g/mol |
| Exact Mass | 461.09 |
| IUPAC Name | (3-nitrophenyl)methyl 2-(4-methyl-2-nitrophenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | Cc1ccc(N2C(=O)c3ccc(C(=O)OCc4cccc([N+](=O)[O-])c4)cc3C2=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H15N3O8/c1-13-5-8-19(20(9-13)26(32)33)24-21(27)17-7-6-15(11-18(17)22(24)28)23(29)34-12-14-3-2-4-16(10-14)25(30)31/h2-11H,12H2,1H3 |
| InChIKey | PGMIFIWQCCYERG-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.39 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|