C22H14N2O6 — CID 5096381
(3-nitrophenyl) 2-(2-methylphenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 5096381) has the molecular formula C22H14N2O6 and a molecular weight of 402.36 g/mol. Its IUPAC name is (3-nitrophenyl) 2-(2-methylphenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | (3-nitrophenyl) 2-(2-methylphenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 5096381 |
| Molecular Formula | C22H14N2O6 |
| Molecular Weight | 402.36 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | (3-nitrophenyl) 2-(2-methylphenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | Cc1ccccc1N1C(=O)c2ccc(C(=O)Oc3cccc([N+](=O)[O-])c3)cc2C1=O |
| InChI | InChI=1S/C22H14N2O6/c1-13-5-2-3-8-19(13)23-20(25)17-10-9-14(11-18(17)21(23)26)22(27)30-16-7-4-6-15(12-16)24(28)29/h2-12H,1H3 |
| InChIKey | BHTLJDVTYAJNOP-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.36 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|