C16H9INO4- — CID 6990160
2-(4-iodo-2-methylphenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 6990160) has the molecular formula C16H9INO4- and a molecular weight of 406.16 g/mol. Its IUPAC name is 2-(4-iodo-2-methylphenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | 2-(4-iodo-2-methylphenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 6990160 |
| Molecular Formula | C16H9INO4- |
| Molecular Weight | 406.16 g/mol |
| Exact Mass | 405.96 |
| IUPAC Name | 2-(4-iodo-2-methylphenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | Cc1cc(I)ccc1N1C(=O)c2ccc(C(=O)[O-])cc2C1=O |
| InChI | InChI=1S/C16H10INO4/c1-8-6-10(17)3-5-13(8)18-14(19)11-4-2-9(16(21)22)7-12(11)15(18)20/h2-7H,1H3,(H,21,22)/p-1 |
| InChIKey | JQFOHRHSVYGSBH-UHFFFAOYSA-M |
| XLogP | 1.76 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.16 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|