C13H6N3O4- — CID 3575165
1,3-dioxo-2-pyrimidin-2-ylisoindole-5-carboxylate (PubChem CID 3575165) has the molecular formula C13H6N3O4- and a molecular weight of 268.21 g/mol. Its IUPAC name is 1,3-dioxo-2-pyrimidin-2-ylisoindole-5-carboxylate.
| Compound Name | 1,3-dioxo-2-pyrimidin-2-ylisoindole-5-carboxylate |
|---|---|
| PubChem CID | 3575165 |
| Molecular Formula | C13H6N3O4- |
| Molecular Weight | 268.21 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | 1,3-dioxo-2-pyrimidin-2-ylisoindole-5-carboxylate |
| SMILES | O=C([O-])c1ccc2c(c1)C(=O)N(c1ncccn1)C2=O |
| InChI | InChI=1S/C13H7N3O4/c17-10-8-3-2-7(12(19)20)6-9(8)11(18)16(10)13-14-4-1-5-15-13/h1-6H,(H,19,20)/p-1 |
| InChIKey | IUHFHKXIELVUJV-UHFFFAOYSA-M |
| XLogP | -0.36 |
| TPSA | 103.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.21 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|