C11H8NO4- — CID 3638476
2-ethyl-1,3-dioxoisoindole-5-carboxylate (PubChem CID 3638476) has the molecular formula C11H8NO4- and a molecular weight of 218.19 g/mol. Its IUPAC name is 2-ethyl-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | 2-ethyl-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 3638476 |
| Molecular Formula | C11H8NO4- |
| Molecular Weight | 218.19 g/mol |
| Exact Mass | 218.05 |
| IUPAC Name | 2-ethyl-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CCN1C(=O)c2ccc(C(=O)[O-])cc2C1=O |
| InChI | InChI=1S/C11H9NO4/c1-2-12-9(13)7-4-3-6(11(15)16)5-8(7)10(12)14/h3-5H,2H2,1H3,(H,15,16)/p-1 |
| InChIKey | FMHDMAFJLDZEKG-UHFFFAOYSA-M |
| XLogP | -0.33 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.19 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|