C36H28N4O8 — CID 160765942
6,13-diethyl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone (PubChem CID 160765942) has the molecular formula C36H28N4O8 and a molecular weight of 644.64 g/mol. Its IUPAC name is 6,13-diethyl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone.
| Compound Name | 6,13-diethyl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
|---|---|
| PubChem CID | 160765942 |
| Molecular Formula | C36H28N4O8 |
| Molecular Weight | 644.64 g/mol |
| Exact Mass | 644.19 |
| IUPAC Name | 6,13-diethyl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
| SMILES | CCN1C(=O)c2ccc3c4c(ccc(c24)C1=O)C(=O)N(CC)C3=O.CCN1C(=O)c2ccc3c4c(ccc(c24)C1=O)C(=O)N(CC)C3=O |
| InChI | InChI=1S/2C18H14N2O4/c2*1-3-19-15(21)9-5-7-11-14-12(18(24)20(4-2)17(11)23)8-6-10(13(9)14)16(19)22/h2*5-8H,3-4H2,1-2H3 |
| InChIKey | RYRMHNWOODREOR-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 149.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.64 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|