C16H9N2O4Y- — CID 58704992
6-ethyl-6-aza-13-azanidatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone;yttrium (PubChem CID 58704992) has the molecular formula C16H9N2O4Y- and a molecular weight of 382.16 g/mol. Its IUPAC name is 6-ethyl-6-aza-13-azanidatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone;yttrium.
| Compound Name | 6-ethyl-6-aza-13-azanidatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone;yttrium |
|---|---|
| PubChem CID | 58704992 |
| Molecular Formula | C16H9N2O4Y- |
| Molecular Weight | 382.16 g/mol |
| Exact Mass | 381.96 |
| IUPAC Name | 6-ethyl-6-aza-13-azanidatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone;yttrium |
| SMILES | CCN1C(=O)c2ccc3c4c(ccc(c24)C1=O)C(=O)[N-]C3=O.[Y] |
| InChI | InChI=1S/C16H10N2O4.Y/c1-2-18-15(21)9-5-3-7-11-8(14(20)17-13(7)19)4-6-10(12(9)11)16(18)22;/h3-6H,2H2,1H3,(H,17,19,20);/p-1 |
| InChIKey | NACORBBWKPUJHM-UHFFFAOYSA-M |
| XLogP | 2.12 |
| TPSA | 85.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.16 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|