C30H42N4O4+2 — CID 101415047
triethyl-[2-[5,7,12,14-tetraoxo-13-[2-(triethylazaniumyl)ethyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl]ethyl]azanium (PubChem CID 101415047) has the molecular formula C30H42N4O4+2 and a molecular weight of 522.69 g/mol. Its IUPAC name is triethyl-[2-[5,7,12,14-tetraoxo-13-[2-(triethylazaniumyl)ethyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl]ethyl]azanium.
| Compound Name | triethyl-[2-[5,7,12,14-tetraoxo-13-[2-(triethylazaniumyl)ethyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl]ethyl]azanium |
|---|---|
| PubChem CID | 101415047 |
| Molecular Formula | C30H42N4O4+2 |
| Molecular Weight | 522.69 g/mol |
| Exact Mass | 522.32 |
| IUPAC Name | triethyl-[2-[5,7,12,14-tetraoxo-13-[2-(triethylazaniumyl)ethyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl]ethyl]azanium |
| SMILES | CC[N+](CC)(CC)CCN1C(=O)c2ccc3c4c(ccc(c24)C1=O)C(=O)N(CC[N+](CC)(CC)CC)C3=O |
| InChI | InChI=1S/C30H42N4O4/c1-7-33(8-2,9-3)19-17-31-27(35)21-13-15-23-26-24(16-14-22(25(21)26)28(31)36)30(38)32(29(23)37)18-20-34(10-4,11-5)12-6/h13-16H,7-12,17-20H2,1-6H3/q+2 |
| InChIKey | UMKAIAMLFSVNPB-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.69 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|