C32H42N2O12 — CID 102139603
6,13-bis[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone (PubChem CID 102139603) has the molecular formula C32H42N2O12 and a molecular weight of 646.69 g/mol. Its IUPAC name is 6,13-bis[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone.
| Compound Name | 6,13-bis[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
|---|---|
| PubChem CID | 102139603 |
| Molecular Formula | C32H42N2O12 |
| Molecular Weight | 646.69 g/mol |
| Exact Mass | 646.27 |
| IUPAC Name | 6,13-bis[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
| SMILES | COCCOCCOCCOCCN1C(=O)c2ccc3c4c(ccc(c24)C1=O)C(=O)N(CCOCCOCCOCCOC)C3=O |
| InChI | InChI=1S/C32H42N2O12/c1-39-11-13-43-19-21-45-17-15-41-9-7-33-29(35)23-3-5-25-28-26(6-4-24(27(23)28)30(33)36)32(38)34(31(25)37)8-10-42-16-18-46-22-20-44-14-12-40-2/h3-6H,7-22H2,1-2H3 |
| InChIKey | RHFPJTCDVVJBMI-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 148.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.69 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|