C25H32BNO7 — CID 122400709
2-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[de]isoquinoline-1,3-dione (PubChem CID 122400709) has the molecular formula C25H32BNO7 and a molecular weight of 469.34 g/mol. Its IUPAC name is 2-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 122400709 |
| Molecular Formula | C25H32BNO7 |
| Molecular Weight | 469.34 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | 2-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[de]isoquinoline-1,3-dione |
| SMILES | COCCOCCOCCN1C(=O)c2cccc3c(B4OC(C)(C)C(C)(C)O4)ccc(c23)C1=O |
| InChI | InChI=1S/C25H32BNO7/c1-24(2)25(3,4)34-26(33-24)20-10-9-19-21-17(20)7-6-8-18(21)22(28)27(23(19)29)11-12-31-15-16-32-14-13-30-5/h6-10H,11-16H2,1-5H3 |
| InChIKey | NYKLMYIXRRZTCM-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|