C24H30BNO4 — CID 90271432
2-hexyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[de]isoquinoline-1,3-dione (PubChem CID 90271432) has the molecular formula C24H30BNO4 and a molecular weight of 407.32 g/mol. Its IUPAC name is 2-hexyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-hexyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 90271432 |
| Molecular Formula | C24H30BNO4 |
| Molecular Weight | 407.32 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | 2-hexyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[de]isoquinoline-1,3-dione |
| SMILES | CCCCCCN1C(=O)c2cccc3c(B4OC(C)(C)C(C)(C)O4)ccc(c23)C1=O |
| InChI | InChI=1S/C24H30BNO4/c1-6-7-8-9-15-26-21(27)17-12-10-11-16-19(14-13-18(20(16)17)22(26)28)25-29-23(2,3)24(4,5)30-25/h10-14H,6-9,15H2,1-5H3 |
| InChIKey | HDZGZEYGAVEAOZ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.32 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|