C32H44BNO4 — CID 70641744
6-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-2-pentadecan-8-ylbenzo[de]isoquinoline-1,3-dione (PubChem CID 70641744) has the molecular formula C32H44BNO4 and a molecular weight of 517.52 g/mol. Its IUPAC name is 6-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-2-pentadecan-8-ylbenzo[de]isoquinoline-1,3-dione.
| Compound Name | 6-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-2-pentadecan-8-ylbenzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 70641744 |
| Molecular Formula | C32H44BNO4 |
| Molecular Weight | 517.52 g/mol |
| Exact Mass | 517.34 |
| IUPAC Name | 6-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-2-pentadecan-8-ylbenzo[de]isoquinoline-1,3-dione |
| SMILES | C=C1OB(c2ccc3c4c(cccc24)C(=O)N(C(CCCCCCC)CCCCCCC)C3=O)OC1(C)C |
| InChI | InChI=1S/C32H44BNO4/c1-6-8-10-12-14-17-24(18-15-13-11-9-7-2)34-30(35)26-20-16-19-25-28(22-21-27(29(25)26)31(34)36)33-37-23(3)32(4,5)38-33/h16,19-22,24H,3,6-15,17-18H2,1-2,4-5H3 |
| InChIKey | YRKVCLZHSJQAHD-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.52 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|