C14H16INO4 — CID 103415708
4-iodo-2-[3-(2-methoxyethoxy)propyl]isoindole-1,3-dione (PubChem CID 103415708) has the molecular formula C14H16INO4 and a molecular weight of 389.19 g/mol. Its IUPAC name is 4-iodo-2-[3-(2-methoxyethoxy)propyl]isoindole-1,3-dione.
| Compound Name | 4-iodo-2-[3-(2-methoxyethoxy)propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 103415708 |
| Molecular Formula | C14H16INO4 |
| Molecular Weight | 389.19 g/mol |
| Exact Mass | 389.01 |
| IUPAC Name | 4-iodo-2-[3-(2-methoxyethoxy)propyl]isoindole-1,3-dione |
| SMILES | COCCOCCCN1C(=O)c2cccc(I)c2C1=O |
| InChI | InChI=1S/C14H16INO4/c1-19-8-9-20-7-3-6-16-13(17)10-4-2-5-11(15)12(10)14(16)18/h2,4-5H,3,6-9H2,1H3 |
| InChIKey | SNZAGQZKXSYMJC-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.19 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|