C11H10INO4S — CID 79785427
4-iodo-2-(2-methylsulfonylethyl)isoindole-1,3-dione (PubChem CID 79785427) has the molecular formula C11H10INO4S and a molecular weight of 379.18 g/mol. Its IUPAC name is 4-iodo-2-(2-methylsulfonylethyl)isoindole-1,3-dione.
| Compound Name | 4-iodo-2-(2-methylsulfonylethyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 79785427 |
| Molecular Formula | C11H10INO4S |
| Molecular Weight | 379.18 g/mol |
| Exact Mass | 378.94 |
| IUPAC Name | 4-iodo-2-(2-methylsulfonylethyl)isoindole-1,3-dione |
| SMILES | CS(=O)(=O)CCN1C(=O)c2cccc(I)c2C1=O |
| InChI | InChI=1S/C11H10INO4S/c1-18(16,17)6-5-13-10(14)7-3-2-4-8(12)9(7)11(13)15/h2-4H,5-6H2,1H3 |
| InChIKey | ZDVBQORXGYRTPO-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.18 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|