C16H13IN2O4S — CID 45379603
2-(1,3-dioxoisoindol-2-yl)-N-(4-iodophenyl)ethanesulfonamide (PubChem CID 45379603) has the molecular formula C16H13IN2O4S and a molecular weight of 456.26 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-(4-iodophenyl)ethanesulfonamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-(4-iodophenyl)ethanesulfonamide |
|---|---|
| PubChem CID | 45379603 |
| Molecular Formula | C16H13IN2O4S |
| Molecular Weight | 456.26 g/mol |
| Exact Mass | 455.96 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-(4-iodophenyl)ethanesulfonamide |
| SMILES | O=C1c2ccccc2C(=O)N1CCS(=O)(=O)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C16H13IN2O4S/c17-11-5-7-12(8-6-11)18-24(22,23)10-9-19-15(20)13-3-1-2-4-14(13)16(19)21/h1-8,18H,9-10H2 |
| InChIKey | SPQWMUHUYAWJQE-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.26 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|