C18H15N3O5S — CID 110356730
2-(1,3-dioxoisoindol-2-yl)-N-(2-methyl-1,3-benzoxazol-7-yl)ethanesulfonamide (PubChem CID 110356730) has the molecular formula C18H15N3O5S and a molecular weight of 385.40 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-(2-methyl-1,3-benzoxazol-7-yl)ethanesulfonamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-(2-methyl-1,3-benzoxazol-7-yl)ethanesulfonamide |
|---|---|
| PubChem CID | 110356730 |
| Molecular Formula | C18H15N3O5S |
| Molecular Weight | 385.40 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-(2-methyl-1,3-benzoxazol-7-yl)ethanesulfonamide |
| SMILES | Cc1nc2cccc(NS(=O)(=O)CCN3C(=O)c4ccccc4C3=O)c2o1 |
| InChI | InChI=1S/C18H15N3O5S/c1-11-19-14-7-4-8-15(16(14)26-11)20-27(24,25)10-9-21-17(22)12-5-2-3-6-13(12)18(21)23/h2-8,20H,9-10H2,1H3 |
| InChIKey | QYHDHCAQEBRJHG-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.40 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|