C30H22N2O6S — CID 58565717
2-(1,3-dioxoisoindol-2-yl)-N-[4-hydroxy-3-(2-hydroxynaphthalen-1-yl)naphthalen-1-yl]ethanesulfonamide (PubChem CID 58565717) has the molecular formula C30H22N2O6S and a molecular weight of 538.58 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-[4-hydroxy-3-(2-hydroxynaphthalen-1-yl)naphthalen-1-yl]ethanesulfonamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-[4-hydroxy-3-(2-hydroxynaphthalen-1-yl)naphthalen-1-yl]ethanesulfonamide |
|---|---|
| PubChem CID | 58565717 |
| Molecular Formula | C30H22N2O6S |
| Molecular Weight | 538.58 g/mol |
| Exact Mass | 538.12 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-[4-hydroxy-3-(2-hydroxynaphthalen-1-yl)naphthalen-1-yl]ethanesulfonamide |
| SMILES | O=C1c2ccccc2C(=O)N1CCS(=O)(=O)Nc1cc(-c2c(O)ccc3ccccc23)c(O)c2ccccc12 |
| InChI | InChI=1S/C30H22N2O6S/c33-26-14-13-18-7-1-2-8-19(18)27(26)24-17-25(20-9-3-4-10-21(20)28(24)34)31-39(37,38)16-15-32-29(35)22-11-5-6-12-23(22)30(32)36/h1-14,17,31,33-34H,15-16H2 |
| InChIKey | YIVFBNZTOPNPMQ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.58 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|