C17H16N2O4S — CID 617178
2-(1,3-dioxoisoindol-2-yl)-N-(4-methylphenyl)ethanesulfonamide (PubChem CID 617178) has the molecular formula C17H16N2O4S and a molecular weight of 344.39 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-(4-methylphenyl)ethanesulfonamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-(4-methylphenyl)ethanesulfonamide |
|---|---|
| PubChem CID | 617178 |
| Molecular Formula | C17H16N2O4S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-(4-methylphenyl)ethanesulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)CCN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C17H16N2O4S/c1-12-6-8-13(9-7-12)18-24(22,23)11-10-19-16(20)14-4-2-3-5-15(14)17(19)21/h2-9,18H,10-11H2,1H3 |
| InChIKey | SOVMNUXPXVZSOS-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|