C25H23N3O5S — CID 1119719
4-(1,3-dioxoisoindol-2-yl)-N-[4-[(4-methylphenyl)sulfonylamino]phenyl]butanamide (PubChem CID 1119719) has the molecular formula C25H23N3O5S and a molecular weight of 477.54 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)-N-[4-[(4-methylphenyl)sulfonylamino]phenyl]butanamide.
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)-N-[4-[(4-methylphenyl)sulfonylamino]phenyl]butanamide |
|---|---|
| PubChem CID | 1119719 |
| Molecular Formula | C25H23N3O5S |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)-N-[4-[(4-methylphenyl)sulfonylamino]phenyl]butanamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(NC(=O)CCCN3C(=O)c4ccccc4C3=O)cc2)cc1 |
| InChI | InChI=1S/C25H23N3O5S/c1-17-8-14-20(15-9-17)34(32,33)27-19-12-10-18(11-13-19)26-23(29)7-4-16-28-24(30)21-5-2-3-6-22(21)25(28)31/h2-3,5-6,8-15,27H,4,7,16H2,1H3,(H,26,29) |
| InChIKey | OTGAIKJAXBEEJE-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|