C31H37N5O5S — CID 3336490
N-[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]-11-(1,3-dioxoisoindol-2-yl)undecanamide (PubChem CID 3336490) has the molecular formula C31H37N5O5S and a molecular weight of 591.73 g/mol. Its IUPAC name is N-[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]-11-(1,3-dioxoisoindol-2-yl)undecanamide.
| Compound Name | N-[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]-11-(1,3-dioxoisoindol-2-yl)undecanamide |
|---|---|
| PubChem CID | 3336490 |
| Molecular Formula | C31H37N5O5S |
| Molecular Weight | 591.73 g/mol |
| Exact Mass | 591.25 |
| IUPAC Name | N-[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]-11-(1,3-dioxoisoindol-2-yl)undecanamide |
| SMILES | Cc1cc(NS(=O)(=O)c2ccc(NC(=O)CCCCCCCCCCN3C(=O)c4ccccc4C3=O)cc2)nc(C)n1 |
| InChI | InChI=1S/C31H37N5O5S/c1-22-21-28(33-23(2)32-22)35-42(40,41)25-18-16-24(17-19-25)34-29(37)15-9-7-5-3-4-6-8-12-20-36-30(38)26-13-10-11-14-27(26)31(36)39/h10-11,13-14,16-19,21H,3-9,12,15,20H2,1-2H3,(H,34,37)(H,32,33,35) |
| InChIKey | NTSCRVACPCNBMR-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 138.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.73 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|