C28H30N6O3 — CID 122295907
4-(1,3-dioxoisoindol-2-yl)-N-[4-[(6-methyl-2-piperidin-1-ylpyrimidin-4-yl)amino]phenyl]butanamide (PubChem CID 122295907) has the molecular formula C28H30N6O3 and a molecular weight of 498.59 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)-N-[4-[(6-methyl-2-piperidin-1-ylpyrimidin-4-yl)amino]phenyl]butanamide.
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)-N-[4-[(6-methyl-2-piperidin-1-ylpyrimidin-4-yl)amino]phenyl]butanamide |
|---|---|
| PubChem CID | 122295907 |
| Molecular Formula | C28H30N6O3 |
| Molecular Weight | 498.59 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)-N-[4-[(6-methyl-2-piperidin-1-ylpyrimidin-4-yl)amino]phenyl]butanamide |
| SMILES | Cc1cc(Nc2ccc(NC(=O)CCCN3C(=O)c4ccccc4C3=O)cc2)nc(N2CCCCC2)n1 |
| InChI | InChI=1S/C28H30N6O3/c1-19-18-24(32-28(29-19)33-15-5-2-6-16-33)30-20-11-13-21(14-12-20)31-25(35)10-7-17-34-26(36)22-8-3-4-9-23(22)27(34)37/h3-4,8-9,11-14,18H,2,5-7,10,15-17H2,1H3,(H,31,35)(H,29,30,32) |
| InChIKey | FFNVMGVQMLWVGM-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.59 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|