C27H28N6O4 — CID 122297382
4-(1,3-dioxoisoindol-2-yl)-N-[4-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]phenyl]butanamide (PubChem CID 122297382) has the molecular formula C27H28N6O4 and a molecular weight of 500.56 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)-N-[4-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]phenyl]butanamide.
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)-N-[4-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]phenyl]butanamide |
|---|---|
| PubChem CID | 122297382 |
| Molecular Formula | C27H28N6O4 |
| Molecular Weight | 500.56 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)-N-[4-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]phenyl]butanamide |
| SMILES | Cc1nc(Nc2ccc(NC(=O)CCCN3C(=O)c4ccccc4C3=O)cc2)cc(N2CCOCC2)n1 |
| InChI | InChI=1S/C27H28N6O4/c1-18-28-23(17-24(29-18)32-13-15-37-16-14-32)30-19-8-10-20(11-9-19)31-25(34)7-4-12-33-26(35)21-5-2-3-6-22(21)27(33)36/h2-3,5-6,8-11,17H,4,7,12-16H2,1H3,(H,31,34)(H,28,29,30) |
| InChIKey | UPLLXYOZGPAXSJ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.56 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|