C23H25N5O3 — CID 122297260
N-[4-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]phenyl]-2-phenoxyacetamide (PubChem CID 122297260) has the molecular formula C23H25N5O3 and a molecular weight of 419.49 g/mol. Its IUPAC name is N-[4-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]phenyl]-2-phenoxyacetamide.
| Compound Name | N-[4-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]phenyl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 122297260 |
| Molecular Formula | C23H25N5O3 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | N-[4-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]phenyl]-2-phenoxyacetamide |
| SMILES | Cc1nc(Nc2ccc(NC(=O)COc3ccccc3)cc2)cc(N2CCOCC2)n1 |
| InChI | InChI=1S/C23H25N5O3/c1-17-24-21(15-22(25-17)28-11-13-30-14-12-28)26-18-7-9-19(10-8-18)27-23(29)16-31-20-5-3-2-4-6-20/h2-10,15H,11-14,16H2,1H3,(H,27,29)(H,24,25,26) |
| InChIKey | OJALQEORFJRXPN-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |