C23H26N6O3 — CID 50748054
1-(3-methoxyphenyl)-3-[4-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]phenyl]urea (PubChem CID 50748054) has the molecular formula C23H26N6O3 and a molecular weight of 434.50 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-3-[4-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]phenyl]urea.
| Compound Name | 1-(3-methoxyphenyl)-3-[4-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]phenyl]urea |
|---|---|
| PubChem CID | 50748054 |
| Molecular Formula | C23H26N6O3 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | 1-(3-methoxyphenyl)-3-[4-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]phenyl]urea |
| SMILES | COc1cccc(NC(=O)Nc2ccc(Nc3cc(N4CCOCC4)nc(C)n3)cc2)c1 |
| InChI | InChI=1S/C23H26N6O3/c1-16-24-21(15-22(25-16)29-10-12-32-13-11-29)26-17-6-8-18(9-7-17)27-23(30)28-19-4-3-5-20(14-19)31-2/h3-9,14-15H,10-13H2,1-2H3,(H,24,25,26)(H2,27,28,30) |
| InChIKey | GGFWARNAMDIOSL-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 100.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |