C23H22F3N5O3 — CID 122297414
2,4,5-trifluoro-3-methoxy-N-[4-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]phenyl]benzamide (PubChem CID 122297414) has the molecular formula C23H22F3N5O3 and a molecular weight of 473.46 g/mol. Its IUPAC name is 2,4,5-trifluoro-3-methoxy-N-[4-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]phenyl]benzamide.
| Compound Name | 2,4,5-trifluoro-3-methoxy-N-[4-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]phenyl]benzamide |
|---|---|
| PubChem CID | 122297414 |
| Molecular Formula | C23H22F3N5O3 |
| Molecular Weight | 473.46 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | 2,4,5-trifluoro-3-methoxy-N-[4-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]phenyl]benzamide |
| SMILES | COc1c(F)c(F)cc(C(=O)Nc2ccc(Nc3cc(N4CCOCC4)nc(C)n3)cc2)c1F |
| InChI | InChI=1S/C23H22F3N5O3/c1-13-27-18(12-19(28-13)31-7-9-34-10-8-31)29-14-3-5-15(6-4-14)30-23(32)16-11-17(24)21(26)22(33-2)20(16)25/h3-6,11-12H,7-10H2,1-2H3,(H,30,32)(H,27,28,29) |
| InChIKey | IPQYBKNIXLYMQD-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.46 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|