C24H26ClN5O2 — CID 50748451
5-chloro-2-methoxy-N-[4-[(2-methyl-6-piperidin-1-ylpyrimidin-4-yl)amino]phenyl]benzamide (PubChem CID 50748451) has the molecular formula C24H26ClN5O2 and a molecular weight of 451.96 g/mol. Its IUPAC name is 5-chloro-2-methoxy-N-[4-[(2-methyl-6-piperidin-1-ylpyrimidin-4-yl)amino]phenyl]benzamide.
| Compound Name | 5-chloro-2-methoxy-N-[4-[(2-methyl-6-piperidin-1-ylpyrimidin-4-yl)amino]phenyl]benzamide |
|---|---|
| PubChem CID | 50748451 |
| Molecular Formula | C24H26ClN5O2 |
| Molecular Weight | 451.96 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | 5-chloro-2-methoxy-N-[4-[(2-methyl-6-piperidin-1-ylpyrimidin-4-yl)amino]phenyl]benzamide |
| SMILES | COc1ccc(Cl)cc1C(=O)Nc1ccc(Nc2cc(N3CCCCC3)nc(C)n2)cc1 |
| InChI | InChI=1S/C24H26ClN5O2/c1-16-26-22(15-23(27-16)30-12-4-3-5-13-30)28-18-7-9-19(10-8-18)29-24(31)20-14-17(25)6-11-21(20)32-2/h6-11,14-15H,3-5,12-13H2,1-2H3,(H,29,31)(H,26,27,28) |
| InChIKey | XNUNBWRZXWDAJK-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.96 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |