C22H19ClN6O2 — CID 121073894
5-chloro-N-[4-[(6-imidazol-1-yl-2-methylpyrimidin-4-yl)amino]phenyl]-2-methoxybenzamide (PubChem CID 121073894) has the molecular formula C22H19ClN6O2 and a molecular weight of 434.89 g/mol. Its IUPAC name is 5-chloro-N-[4-[(6-imidazol-1-yl-2-methylpyrimidin-4-yl)amino]phenyl]-2-methoxybenzamide.
| Compound Name | 5-chloro-N-[4-[(6-imidazol-1-yl-2-methylpyrimidin-4-yl)amino]phenyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 121073894 |
| Molecular Formula | C22H19ClN6O2 |
| Molecular Weight | 434.89 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | 5-chloro-N-[4-[(6-imidazol-1-yl-2-methylpyrimidin-4-yl)amino]phenyl]-2-methoxybenzamide |
| SMILES | COc1ccc(Cl)cc1C(=O)Nc1ccc(Nc2cc(-n3ccnc3)nc(C)n2)cc1 |
| InChI | InChI=1S/C22H19ClN6O2/c1-14-25-20(12-21(26-14)29-10-9-24-13-29)27-16-4-6-17(7-5-16)28-22(30)18-11-15(23)3-8-19(18)31-2/h3-13H,1-2H3,(H,28,30)(H,25,26,27) |
| InChIKey | XZFULHMSTCVCAU-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.89 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |