C21H18ClN7O — CID 56920689
1-(2-chlorophenyl)-3-[4-[(6-imidazol-1-yl-2-methylpyrimidin-4-yl)amino]phenyl]urea (PubChem CID 56920689) has the molecular formula C21H18ClN7O and a molecular weight of 419.88 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-[4-[(6-imidazol-1-yl-2-methylpyrimidin-4-yl)amino]phenyl]urea.
| Compound Name | 1-(2-chlorophenyl)-3-[4-[(6-imidazol-1-yl-2-methylpyrimidin-4-yl)amino]phenyl]urea |
|---|---|
| PubChem CID | 56920689 |
| Molecular Formula | C21H18ClN7O |
| Molecular Weight | 419.88 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | 1-(2-chlorophenyl)-3-[4-[(6-imidazol-1-yl-2-methylpyrimidin-4-yl)amino]phenyl]urea |
| SMILES | Cc1nc(Nc2ccc(NC(=O)Nc3ccccc3Cl)cc2)cc(-n2ccnc2)n1 |
| InChI | InChI=1S/C21H18ClN7O/c1-14-24-19(12-20(25-14)29-11-10-23-13-29)26-15-6-8-16(9-7-15)27-21(30)28-18-5-3-2-4-17(18)22/h2-13H,1H3,(H,24,25,26)(H2,27,28,30) |
| InChIKey | FASLCTTXDJNEPW-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.88 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |