C22H18ClN5O2 — CID 122309284
1-(2-chlorophenyl)-3-[4-(2-methyl-6-pyrrol-1-ylpyrimidin-4-yl)oxyphenyl]urea (PubChem CID 122309284) has the molecular formula C22H18ClN5O2 and a molecular weight of 419.87 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-[4-(2-methyl-6-pyrrol-1-ylpyrimidin-4-yl)oxyphenyl]urea.
| Compound Name | 1-(2-chlorophenyl)-3-[4-(2-methyl-6-pyrrol-1-ylpyrimidin-4-yl)oxyphenyl]urea |
|---|---|
| PubChem CID | 122309284 |
| Molecular Formula | C22H18ClN5O2 |
| Molecular Weight | 419.87 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | 1-(2-chlorophenyl)-3-[4-(2-methyl-6-pyrrol-1-ylpyrimidin-4-yl)oxyphenyl]urea |
| SMILES | Cc1nc(Oc2ccc(NC(=O)Nc3ccccc3Cl)cc2)cc(-n2cccc2)n1 |
| InChI | InChI=1S/C22H18ClN5O2/c1-15-24-20(28-12-4-5-13-28)14-21(25-15)30-17-10-8-16(9-11-17)26-22(29)27-19-7-3-2-6-18(19)23/h2-14H,1H3,(H2,26,27,29) |
| InChIKey | HXUCJRFPZIFCAG-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.87 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |