C26H21N5O2 — CID 122309272
1-[4-(2-methyl-6-pyrrol-1-ylpyrimidin-4-yl)oxyphenyl]-3-naphthalen-2-ylurea (PubChem CID 122309272) has the molecular formula C26H21N5O2 and a molecular weight of 435.49 g/mol. Its IUPAC name is 1-[4-(2-methyl-6-pyrrol-1-ylpyrimidin-4-yl)oxyphenyl]-3-naphthalen-2-ylurea.
| Compound Name | 1-[4-(2-methyl-6-pyrrol-1-ylpyrimidin-4-yl)oxyphenyl]-3-naphthalen-2-ylurea |
|---|---|
| PubChem CID | 122309272 |
| Molecular Formula | C26H21N5O2 |
| Molecular Weight | 435.49 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 1-[4-(2-methyl-6-pyrrol-1-ylpyrimidin-4-yl)oxyphenyl]-3-naphthalen-2-ylurea |
| SMILES | Cc1nc(Oc2ccc(NC(=O)Nc3ccc4ccccc4c3)cc2)cc(-n2cccc2)n1 |
| InChI | InChI=1S/C26H21N5O2/c1-18-27-24(31-14-4-5-15-31)17-25(28-18)33-23-12-10-21(11-13-23)29-26(32)30-22-9-8-19-6-2-3-7-20(19)16-22/h2-17H,1H3,(H2,29,30,32) |
| InChIKey | DFCSCAZIAPMSPN-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.49 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |