C26H25N5O4 — CID 122297017
8-methoxy-N-[4-[(2-methyl-6-pyrrolidin-1-ylpyrimidin-4-yl)amino]phenyl]-2-oxochromene-3-carboxamide (PubChem CID 122297017) has the molecular formula C26H25N5O4 and a molecular weight of 471.52 g/mol. Its IUPAC name is 8-methoxy-N-[4-[(2-methyl-6-pyrrolidin-1-ylpyrimidin-4-yl)amino]phenyl]-2-oxochromene-3-carboxamide.
| Compound Name | 8-methoxy-N-[4-[(2-methyl-6-pyrrolidin-1-ylpyrimidin-4-yl)amino]phenyl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 122297017 |
| Molecular Formula | C26H25N5O4 |
| Molecular Weight | 471.52 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | 8-methoxy-N-[4-[(2-methyl-6-pyrrolidin-1-ylpyrimidin-4-yl)amino]phenyl]-2-oxochromene-3-carboxamide |
| SMILES | COc1cccc2cc(C(=O)Nc3ccc(Nc4cc(N5CCCC5)nc(C)n4)cc3)c(=O)oc12 |
| InChI | InChI=1S/C26H25N5O4/c1-16-27-22(15-23(28-16)31-12-3-4-13-31)29-18-8-10-19(11-9-18)30-25(32)20-14-17-6-5-7-21(34-2)24(17)35-26(20)33/h5-11,14-15H,3-4,12-13H2,1-2H3,(H,30,32)(H,27,28,29) |
| InChIKey | LHKSDGJFFVFOOL-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 109.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.52 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|