C27H23N5O5 — CID 122310489
N-[4-[6-(3,5-dimethylpyrazol-1-yl)-2-methylpyrimidin-4-yl]oxyphenyl]-8-methoxy-2-oxochromene-3-carboxamide (PubChem CID 122310489) has the molecular formula C27H23N5O5 and a molecular weight of 497.51 g/mol. Its IUPAC name is N-[4-[6-(3,5-dimethylpyrazol-1-yl)-2-methylpyrimidin-4-yl]oxyphenyl]-8-methoxy-2-oxochromene-3-carboxamide.
| Compound Name | N-[4-[6-(3,5-dimethylpyrazol-1-yl)-2-methylpyrimidin-4-yl]oxyphenyl]-8-methoxy-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 122310489 |
| Molecular Formula | C27H23N5O5 |
| Molecular Weight | 497.51 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | N-[4-[6-(3,5-dimethylpyrazol-1-yl)-2-methylpyrimidin-4-yl]oxyphenyl]-8-methoxy-2-oxochromene-3-carboxamide |
| SMILES | COc1cccc2cc(C(=O)Nc3ccc(Oc4cc(-n5nc(C)cc5C)nc(C)n4)cc3)c(=O)oc12 |
| InChI | InChI=1S/C27H23N5O5/c1-15-12-16(2)32(31-15)23-14-24(29-17(3)28-23)36-20-10-8-19(9-11-20)30-26(33)21-13-18-6-5-7-22(35-4)25(18)37-27(21)34/h5-14H,1-4H3,(H,30,33) |
| InChIKey | DTDNEIRUZYJNPN-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 121.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.51 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|