C21H18N2O5 — CID 26458989
8-methoxy-2-oxo-N-[3-(2-oxopyrrolidin-1-yl)phenyl]chromene-3-carboxamide (PubChem CID 26458989) has the molecular formula C21H18N2O5 and a molecular weight of 378.38 g/mol. Its IUPAC name is 8-methoxy-2-oxo-N-[3-(2-oxopyrrolidin-1-yl)phenyl]chromene-3-carboxamide.
| Compound Name | 8-methoxy-2-oxo-N-[3-(2-oxopyrrolidin-1-yl)phenyl]chromene-3-carboxamide |
|---|---|
| PubChem CID | 26458989 |
| Molecular Formula | C21H18N2O5 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 8-methoxy-2-oxo-N-[3-(2-oxopyrrolidin-1-yl)phenyl]chromene-3-carboxamide |
| SMILES | COc1cccc2cc(C(=O)Nc3cccc(N4CCCC4=O)c3)c(=O)oc12 |
| InChI | InChI=1S/C21H18N2O5/c1-27-17-8-2-5-13-11-16(21(26)28-19(13)17)20(25)22-14-6-3-7-15(12-14)23-10-4-9-18(23)24/h2-3,5-8,11-12H,4,9-10H2,1H3,(H,22,25) |
| InChIKey | VJDCZPMSZUUQFU-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|