C24H16F3NO5 — CID 86650395
8-methoxy-2-oxo-N-[3-[2-(trifluoromethoxy)phenyl]phenyl]chromene-3-carboxamide (PubChem CID 86650395) has the molecular formula C24H16F3NO5 and a molecular weight of 455.39 g/mol. Its IUPAC name is 8-methoxy-2-oxo-N-[3-[2-(trifluoromethoxy)phenyl]phenyl]chromene-3-carboxamide.
| Compound Name | 8-methoxy-2-oxo-N-[3-[2-(trifluoromethoxy)phenyl]phenyl]chromene-3-carboxamide |
|---|---|
| PubChem CID | 86650395 |
| Molecular Formula | C24H16F3NO5 |
| Molecular Weight | 455.39 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | 8-methoxy-2-oxo-N-[3-[2-(trifluoromethoxy)phenyl]phenyl]chromene-3-carboxamide |
| SMILES | COc1cccc2cc(C(=O)Nc3cccc(-c4ccccc4OC(F)(F)F)c3)c(=O)oc12 |
| InChI | InChI=1S/C24H16F3NO5/c1-31-20-11-5-7-15-13-18(23(30)32-21(15)20)22(29)28-16-8-4-6-14(12-16)17-9-2-3-10-19(17)33-24(25,26)27/h2-13H,1H3,(H,28,29) |
| InChIKey | FOZPMRFXLCPWGP-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.39 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|