C26H24N2O6 — CID 86650467
tert-butyl 2-[3-[(8-methoxy-2-oxochromene-3-carbonyl)amino]phenyl]pyrrole-1-carboxylate (PubChem CID 86650467) has the molecular formula C26H24N2O6 and a molecular weight of 460.49 g/mol. Its IUPAC name is tert-butyl 2-[3-[(8-methoxy-2-oxochromene-3-carbonyl)amino]phenyl]pyrrole-1-carboxylate.
| Compound Name | tert-butyl 2-[3-[(8-methoxy-2-oxochromene-3-carbonyl)amino]phenyl]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 86650467 |
| Molecular Formula | C26H24N2O6 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | tert-butyl 2-[3-[(8-methoxy-2-oxochromene-3-carbonyl)amino]phenyl]pyrrole-1-carboxylate |
| SMILES | COc1cccc2cc(C(=O)Nc3cccc(-c4cccn4C(=O)OC(C)(C)C)c3)c(=O)oc12 |
| InChI | InChI=1S/C26H24N2O6/c1-26(2,3)34-25(31)28-13-7-11-20(28)16-8-5-10-18(14-16)27-23(29)19-15-17-9-6-12-21(32-4)22(17)33-24(19)30/h5-15H,1-4H3,(H,27,29) |
| InChIKey | LSLOWLNCZBUPOB-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|