C18H13N5O4 — CID 122300789
N-(2-imidazol-1-ylpyrimidin-5-yl)-8-methoxy-2-oxochromene-3-carboxamide (PubChem CID 122300789) has the molecular formula C18H13N5O4 and a molecular weight of 363.33 g/mol. Its IUPAC name is N-(2-imidazol-1-ylpyrimidin-5-yl)-8-methoxy-2-oxochromene-3-carboxamide.
| Compound Name | N-(2-imidazol-1-ylpyrimidin-5-yl)-8-methoxy-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 122300789 |
| Molecular Formula | C18H13N5O4 |
| Molecular Weight | 363.33 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | N-(2-imidazol-1-ylpyrimidin-5-yl)-8-methoxy-2-oxochromene-3-carboxamide |
| SMILES | COc1cccc2cc(C(=O)Nc3cnc(-n4ccnc4)nc3)c(=O)oc12 |
| InChI | InChI=1S/C18H13N5O4/c1-26-14-4-2-3-11-7-13(17(25)27-15(11)14)16(24)22-12-8-20-18(21-9-12)23-6-5-19-10-23/h2-10H,1H3,(H,22,24) |
| InChIKey | WAJBXHWSQBPANL-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 112.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.33 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|