C17H13N5O3 — CID 122300248
7-methoxy-N-(2-pyrazol-1-ylpyrimidin-5-yl)-1-benzofuran-2-carboxamide (PubChem CID 122300248) has the molecular formula C17H13N5O3 and a molecular weight of 335.32 g/mol. Its IUPAC name is 7-methoxy-N-(2-pyrazol-1-ylpyrimidin-5-yl)-1-benzofuran-2-carboxamide.
| Compound Name | 7-methoxy-N-(2-pyrazol-1-ylpyrimidin-5-yl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 122300248 |
| Molecular Formula | C17H13N5O3 |
| Molecular Weight | 335.32 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 7-methoxy-N-(2-pyrazol-1-ylpyrimidin-5-yl)-1-benzofuran-2-carboxamide |
| SMILES | COc1cccc2cc(C(=O)Nc3cnc(-n4cccn4)nc3)oc12 |
| InChI | InChI=1S/C17H13N5O3/c1-24-13-5-2-4-11-8-14(25-15(11)13)16(23)21-12-9-18-17(19-10-12)22-7-3-6-20-22/h2-10H,1H3,(H,21,23) |
| InChIKey | RTCXECMIENSUCJ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 95.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.32 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |