C14H12N4O3 — CID 91527109
N-(4-aminopyrimidin-5-yl)-7-methoxy-1-benzofuran-2-carboxamide (PubChem CID 91527109) has the molecular formula C14H12N4O3 and a molecular weight of 284.28 g/mol. Its IUPAC name is N-(4-aminopyrimidin-5-yl)-7-methoxy-1-benzofuran-2-carboxamide.
| Compound Name | N-(4-aminopyrimidin-5-yl)-7-methoxy-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 91527109 |
| Molecular Formula | C14H12N4O3 |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | N-(4-aminopyrimidin-5-yl)-7-methoxy-1-benzofuran-2-carboxamide |
| SMILES | COc1cccc2cc(C(=O)Nc3cncnc3N)oc12 |
| InChI | InChI=1S/C14H12N4O3/c1-20-10-4-2-3-8-5-11(21-12(8)10)14(19)18-9-6-16-7-17-13(9)15/h2-7H,1H3,(H,18,19)(H2,15,16,17) |
| InChIKey | ARGITXHWZGRCMI-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 103.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |