C17H18N4O4 — CID 122319384
N-[4-(dimethylamino)-2-methoxypyrimidin-5-yl]-7-methoxy-1-benzofuran-2-carboxamide (PubChem CID 122319384) has the molecular formula C17H18N4O4 and a molecular weight of 342.36 g/mol. Its IUPAC name is N-[4-(dimethylamino)-2-methoxypyrimidin-5-yl]-7-methoxy-1-benzofuran-2-carboxamide.
| Compound Name | N-[4-(dimethylamino)-2-methoxypyrimidin-5-yl]-7-methoxy-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 122319384 |
| Molecular Formula | C17H18N4O4 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | N-[4-(dimethylamino)-2-methoxypyrimidin-5-yl]-7-methoxy-1-benzofuran-2-carboxamide |
| SMILES | COc1ncc(NC(=O)c2cc3cccc(OC)c3o2)c(N(C)C)n1 |
| InChI | InChI=1S/C17H18N4O4/c1-21(2)15-11(9-18-17(20-15)24-4)19-16(22)13-8-10-6-5-7-12(23-3)14(10)25-13/h5-9H,1-4H3,(H,19,22) |
| InChIKey | MHHYVTABPSWISY-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 89.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |